C29H32BrN3O6 — CID 126320276
N-[(E)-[3-bromo-5-ethoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxy-4-propoxybenzamide (PubChem CID 126320276) has the molecular formula C29H32BrN3O6 and a molecular weight of 598.49 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-ethoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxy-4-propoxybenzamide.
| Compound Name | N-[(E)-[3-bromo-5-ethoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 126320276 |
| Molecular Formula | C29H32BrN3O6 |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | N-[(E)-[3-bromo-5-ethoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxy-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2cc(Br)c(OCC(=O)Nc3cccc(C)c3)c(OCC)c2)cc1OC |
| InChI | InChI=1S/C29H32BrN3O6/c1-5-12-38-24-11-10-21(16-25(24)36-4)29(35)33-31-17-20-14-23(30)28(26(15-20)37-6-2)39-18-27(34)32-22-9-7-8-19(3)13-22/h7-11,13-17H,5-6,12,18H2,1-4H3,(H,32,34)(H,33,35)/b31-17+ |
| InChIKey | RIHDLBXLKUSMDM-KBVAKVRCSA-N |
| XLogP | 5.74 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|