C20H23BrN2O5 — CID 126320857
N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-3,4-diethoxybenzamide (PubChem CID 126320857) has the molecular formula C20H23BrN2O5 and a molecular weight of 451.32 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-3,4-diethoxybenzamide.
| Compound Name | N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 126320857 |
| Molecular Formula | C20H23BrN2O5 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Br)c(OC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C20H23BrN2O5/c1-5-27-16-8-7-14(11-17(16)28-6-2)20(24)23-22-12-13-9-15(21)19(26-4)18(10-13)25-3/h7-12H,5-6H2,1-4H3,(H,23,24)/b22-12+ |
| InChIKey | GZKMTJXOVMPBEZ-WSDLNYQXSA-N |
| XLogP | 4.03 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|