C27H27BrN2O7 — CID 126327206
4-[[2-bromo-4-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126327206) has the molecular formula C27H27BrN2O7 and a molecular weight of 571.42 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126327206 |
| Molecular Formula | C27H27BrN2O7 |
| Molecular Weight | 571.42 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | 4-[[2-bromo-4-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Br)c(OCc3ccc(C(=O)O)cc3)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C27H27BrN2O7/c1-4-35-22-11-10-20(14-23(22)36-5-2)26(31)30-29-15-18-12-21(28)25(24(13-18)34-3)37-16-17-6-8-19(9-7-17)27(32)33/h6-15H,4-5,16H2,1-3H3,(H,30,31)(H,32,33)/b29-15+ |
| InChIKey | DKNSXFODPSALJB-WKULSOCRSA-N |
| XLogP | 5.30 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|