C33H33BrN2O5 — CID 126329877
N-[(E)-[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide (PubChem CID 126329877) has the molecular formula C33H33BrN2O5 and a molecular weight of 617.54 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126329877 |
| Molecular Formula | C33H33BrN2O5 |
| Molecular Weight | 617.54 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | N-[(E)-[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
| SMILES | CCOc1cc(C(=O)N/N=C/c2cc(Br)c(OCc3ccc(C)cc3)c(OCC)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H33BrN2O5/c1-4-38-30-19-27(15-16-29(30)40-21-24-9-7-6-8-10-24)33(37)36-35-20-26-17-28(34)32(31(18-26)39-5-2)41-22-25-13-11-23(3)12-14-25/h6-20H,4-5,21-22H2,1-3H3,(H,36,37)/b35-20+ |
| InChIKey | PPEYOXCYNBHQPO-JEPNHJGPSA-N |
| XLogP | 7.48 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.54 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|