C25H25BrN2O4 — CID 29148647
N-[(Z)-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-4-ethoxybenzamide (PubChem CID 29148647) has the molecular formula C25H25BrN2O4 and a molecular weight of 497.39 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-4-ethoxybenzamide.
| Compound Name | N-[(Z)-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 29148647 |
| Molecular Formula | C25H25BrN2O4 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | N-[(Z)-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C\c2cc(Br)c(OCc3ccccc3)c(OCC)c2)cc1 |
| InChI | InChI=1S/C25H25BrN2O4/c1-3-30-21-12-10-20(11-13-21)25(29)28-27-16-19-14-22(26)24(23(15-19)31-4-2)32-17-18-8-6-5-7-9-18/h5-16H,3-4,17H2,1-2H3,(H,28,29)/b27-16- |
| InChIKey | BFLYHOOZBOPQTA-YUMHPJSZSA-N |
| XLogP | 5.59 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|