C23H20Br2N2O3 — CID 124537175
N-[(Z)-(3,5-dibromo-4-phenylmethoxyphenyl)methylideneamino]-4-ethoxybenzamide (PubChem CID 124537175) has the molecular formula C23H20Br2N2O3 and a molecular weight of 532.23 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-4-phenylmethoxyphenyl)methylideneamino]-4-ethoxybenzamide.
| Compound Name | N-[(Z)-(3,5-dibromo-4-phenylmethoxyphenyl)methylideneamino]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 124537175 |
| Molecular Formula | C23H20Br2N2O3 |
| Molecular Weight | 532.23 g/mol |
| Exact Mass | 529.98 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-4-phenylmethoxyphenyl)methylideneamino]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C\c2cc(Br)c(OCc3ccccc3)c(Br)c2)cc1 |
| InChI | InChI=1S/C23H20Br2N2O3/c1-2-29-19-10-8-18(9-11-19)23(28)27-26-14-17-12-20(24)22(21(25)13-17)30-15-16-6-4-3-5-7-16/h3-14H,2,15H2,1H3,(H,27,28)/b26-14- |
| InChIKey | FOSKEKNLEQWSAO-WGARJPEWSA-N |
| XLogP | 5.95 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.23 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|