C26H24BrN3O4 — CID 29148898
N-[(Z)-[3-bromo-4-[(4-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-4-ethoxybenzamide (PubChem CID 29148898) has the molecular formula C26H24BrN3O4 and a molecular weight of 522.40 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(4-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-4-ethoxybenzamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(4-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 29148898 |
| Molecular Formula | C26H24BrN3O4 |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(4-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C\c2cc(Br)c(OCc3ccc(C#N)cc3)c(OCC)c2)cc1 |
| InChI | InChI=1S/C26H24BrN3O4/c1-3-32-22-11-9-21(10-12-22)26(31)30-29-16-20-13-23(27)25(24(14-20)33-4-2)34-17-19-7-5-18(15-28)6-8-19/h5-14,16H,3-4,17H2,1-2H3,(H,30,31)/b29-16- |
| InChIKey | TZPOUEZZNDQRJY-MWLSYYOVSA-N |
| XLogP | 5.46 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|