C33H32ClN3O6 — CID 126265967
N-[(E)-[4-(2-anilino-2-oxoethoxy)-3-chloro-5-ethoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide (PubChem CID 126265967) has the molecular formula C33H32ClN3O6 and a molecular weight of 602.09 g/mol. Its IUPAC name is N-[(E)-[4-(2-anilino-2-oxoethoxy)-3-chloro-5-ethoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[4-(2-anilino-2-oxoethoxy)-3-chloro-5-ethoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126265967 |
| Molecular Formula | C33H32ClN3O6 |
| Molecular Weight | 602.09 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | N-[(E)-[4-(2-anilino-2-oxoethoxy)-3-chloro-5-ethoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
| SMILES | CCOc1cc(C(=O)N/N=C/c2cc(Cl)c(OCC(=O)Nc3ccccc3)c(OCC)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H32ClN3O6/c1-3-40-29-19-25(15-16-28(29)42-21-23-11-7-5-8-12-23)33(39)37-35-20-24-17-27(34)32(30(18-24)41-4-2)43-22-31(38)36-26-13-9-6-10-14-26/h5-20H,3-4,21-22H2,1-2H3,(H,36,38)(H,37,39)/b35-20+ |
| InChIKey | FOWJPXDBEUHNQT-JEPNHJGPSA-N |
| XLogP | 6.50 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.09 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|