C31H28Cl2N2O5 — CID 126337761
N-[(E)-[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide (PubChem CID 126337761) has the molecular formula C31H28Cl2N2O5 and a molecular weight of 579.48 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126337761 |
| Molecular Formula | C31H28Cl2N2O5 |
| Molecular Weight | 579.48 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | N-[(E)-[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
| SMILES | CCOc1cc(C(=O)N/N=C/c2cc(Cl)c(OCc3cccc(Cl)c3)c(OC)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H28Cl2N2O5/c1-3-38-28-17-24(12-13-27(28)39-19-21-8-5-4-6-9-21)31(36)35-34-18-23-15-26(33)30(29(16-23)37-2)40-20-22-10-7-11-25(32)14-22/h4-18H,3,19-20H2,1-2H3,(H,35,36)/b34-18+ |
| InChIKey | GPWKHHSEEYAZFM-FABQOPTDSA-N |
| XLogP | 7.32 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.48 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|