C24H23ClN2O4 — CID 126316989
N-[(E)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]-4-ethoxy-3-methoxybenzamide (PubChem CID 126316989) has the molecular formula C24H23ClN2O4 and a molecular weight of 438.91 g/mol. Its IUPAC name is N-[(E)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]-4-ethoxy-3-methoxybenzamide.
| Compound Name | N-[(E)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]-4-ethoxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 126316989 |
| Molecular Formula | C24H23ClN2O4 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-[(E)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]-4-ethoxy-3-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2ccc(OCc3ccccc3)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C24H23ClN2O4/c1-3-30-22-12-10-19(14-23(22)29-2)24(28)27-26-15-18-9-11-21(20(25)13-18)31-16-17-7-5-4-6-8-17/h4-15H,3,16H2,1-2H3,(H,27,28)/b26-15+ |
| InChIKey | WXGNKAPGBZJLPT-CVKSISIWSA-N |
| XLogP | 5.09 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|