C30H26ClN3O6 — CID 126328691
N-[(E)-[3-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide (PubChem CID 126328691) has the molecular formula C30H26ClN3O6 and a molecular weight of 560.01 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126328691 |
| Molecular Formula | C30H26ClN3O6 |
| Molecular Weight | 560.01 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | N-[(E)-[3-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
| SMILES | CCOc1cc(C(=O)N/N=C/c2ccc(OCc3ccc([N+](=O)[O-])cc3)c(Cl)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H26ClN3O6/c1-2-38-29-17-24(11-15-28(29)40-19-21-6-4-3-5-7-21)30(35)33-32-18-23-10-14-27(26(31)16-23)39-20-22-8-12-25(13-9-22)34(36)37/h3-18H,2,19-20H2,1H3,(H,33,35)/b32-18+ |
| InChIKey | KHTLTRYCHYGMRO-KCSSXMTESA-N |
| XLogP | 6.57 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.01 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|