C25H25N3O7 — CID 126329395
N-[(E)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide (PubChem CID 126329395) has the molecular formula C25H25N3O7 and a molecular weight of 479.49 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide.
| Compound Name | N-[(E)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 126329395 |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(OC)c(OC)c2)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H25N3O7/c1-4-34-24-13-18(7-11-22(24)35-16-17-5-9-20(10-6-17)28(30)31)15-26-27-25(29)19-8-12-21(32-2)23(14-19)33-3/h5-15H,4,16H2,1-3H3,(H,27,29)/b26-15+ |
| InChIKey | ZZXOFAPVKYOFFG-CVKSISIWSA-N |
| XLogP | 4.35 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|