C25H25ClN2O5 — CID 3856625
N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide (PubChem CID 3856625) has the molecular formula C25H25ClN2O5 and a molecular weight of 468.94 g/mol. Its IUPAC name is N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide.
| Compound Name | N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3856625 |
| Molecular Formula | C25H25ClN2O5 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide |
| SMILES | CCOc1cc(C=NNC(=O)c2ccc(OC)c(OC)c2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClN2O5/c1-4-32-24-13-18(7-11-22(24)33-16-17-5-9-20(26)10-6-17)15-27-28-25(29)19-8-12-21(30-2)23(14-19)31-3/h5-15H,4,16H2,1-3H3,(H,28,29) |
| InChIKey | FRUYGDURINBJNQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|