C23H20Cl2N2O3 — CID 126058582
3-chloro-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-methylbenzamide (PubChem CID 126058582) has the molecular formula C23H20Cl2N2O3 and a molecular weight of 443.33 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-methylbenzamide.
| Compound Name | 3-chloro-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 126058582 |
| Molecular Formula | C23H20Cl2N2O3 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 3-chloro-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-methylbenzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(C)c(Cl)c2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20Cl2N2O3/c1-15-3-7-18(12-20(15)25)23(28)27-26-13-17-6-10-21(22(11-17)29-2)30-14-16-4-8-19(24)9-5-16/h3-13H,14H2,1-2H3,(H,27,28)/b26-13- |
| InChIKey | GLXHUWINSCVOAZ-ZMFRSBBQSA-N |
| XLogP | 5.65 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|