C25H23ClN2O6 — CID 126323080
4-[[2-chloro-4-[(E)-[(4-ethoxy-3-methoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126323080) has the molecular formula C25H23ClN2O6 and a molecular weight of 482.92 g/mol. Its IUPAC name is 4-[[2-chloro-4-[(E)-[(4-ethoxy-3-methoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-chloro-4-[(E)-[(4-ethoxy-3-methoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126323080 |
| Molecular Formula | C25H23ClN2O6 |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 4-[[2-chloro-4-[(E)-[(4-ethoxy-3-methoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2ccc(OCc3ccc(C(=O)O)cc3)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C25H23ClN2O6/c1-3-33-22-11-9-19(13-23(22)32-2)24(29)28-27-14-17-6-10-21(20(26)12-17)34-15-16-4-7-18(8-5-16)25(30)31/h4-14H,3,15H2,1-2H3,(H,28,29)(H,30,31)/b27-14+ |
| InChIKey | RRSBUKYBBODXNE-MZJWZYIUSA-N |
| XLogP | 4.79 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|