C28H30N2O7 — CID 126331066
4-[[2-ethoxy-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126331066) has the molecular formula C28H30N2O7 and a molecular weight of 506.56 g/mol. Its IUPAC name is 4-[[2-ethoxy-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-ethoxy-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126331066 |
| Molecular Formula | C28H30N2O7 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 4-[[2-ethoxy-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2ccc(OCc3ccc(C(=O)O)cc3)c(OCC)c2)cc1OC |
| InChI | InChI=1S/C28H30N2O7/c1-4-14-36-23-13-11-22(16-25(23)34-3)27(31)30-29-17-20-8-12-24(26(15-20)35-5-2)37-18-19-6-9-21(10-7-19)28(32)33/h6-13,15-17H,4-5,14,18H2,1-3H3,(H,30,31)(H,32,33)/b29-17+ |
| InChIKey | WLCWHYZKKUBICL-STBIYBPSSA-N |
| XLogP | 4.92 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|