C29H26N2O6 — CID 6061464
4-[[2-ethoxy-4-[(Z)-[(3-methoxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 6061464) has the molecular formula C29H26N2O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is 4-[[2-ethoxy-4-[(Z)-[(3-methoxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-ethoxy-4-[(Z)-[(3-methoxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 6061464 |
| Molecular Formula | C29H26N2O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 4-[[2-ethoxy-4-[(Z)-[(3-methoxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc3ccccc3cc2OC)ccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C29H26N2O6/c1-3-36-27-14-20(10-13-25(27)37-18-19-8-11-21(12-9-19)29(33)34)17-30-31-28(32)24-15-22-6-4-5-7-23(22)16-26(24)35-2/h4-17H,3,18H2,1-2H3,(H,31,32)(H,33,34)/b30-17- |
| InChIKey | DJLCZQYPYGUVEI-LQNQUEJISA-N |
| XLogP | 5.29 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|