C24H23FN2O4 — CID 6872882
N-[(E)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methoxybenzamide (PubChem CID 6872882) has the molecular formula C24H23FN2O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methoxybenzamide.
| Compound Name | N-[(E)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 6872882 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methoxybenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(OC)cc2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H23FN2O4/c1-3-30-23-14-18(6-13-22(23)31-16-17-4-9-20(25)10-5-17)15-26-27-24(28)19-7-11-21(29-2)12-8-19/h4-15H,3,16H2,1-2H3,(H,27,28)/b26-15+ |
| InChIKey | XFQKCSJLHPTLGA-CVKSISIWSA-N |
| XLogP | 4.58 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|