C25H24BrFN2O4 — CID 126331879
N-[(E)-[3-bromo-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide (PubChem CID 126331879) has the molecular formula C25H24BrFN2O4 and a molecular weight of 515.38 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide.
| Compound Name | N-[(E)-[3-bromo-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 126331879 |
| Molecular Formula | C25H24BrFN2O4 |
| Molecular Weight | 515.38 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2ccc(OCc3ccc(F)cc3)c(Br)c2)cc1OCC |
| InChI | InChI=1S/C25H24BrFN2O4/c1-3-31-23-12-8-19(14-24(23)32-4-2)25(30)29-28-15-18-7-11-22(21(26)13-18)33-16-17-5-9-20(27)10-6-17/h5-15H,3-4,16H2,1-2H3,(H,29,30)/b28-15+ |
| InChIKey | AGYZOUGACPAWMF-RWPZCVJISA-N |
| XLogP | 5.73 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.38 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|