C27H29FN2O5 — CID 126325507
3,4-diethoxy-N-[(E)-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 126325507) has the molecular formula C27H29FN2O5 and a molecular weight of 480.54 g/mol. Its IUPAC name is 3,4-diethoxy-N-[(E)-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 3,4-diethoxy-N-[(E)-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126325507 |
| Molecular Formula | C27H29FN2O5 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 3,4-diethoxy-N-[(E)-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2ccc(OCc3cccc(F)c3)c(OCC)c2)cc1OCC |
| InChI | InChI=1S/C27H29FN2O5/c1-4-32-23-13-11-21(16-26(23)34-6-3)27(31)30-29-17-19-10-12-24(25(15-19)33-5-2)35-18-20-8-7-9-22(28)14-20/h7-17H,4-6,18H2,1-3H3,(H,30,31)/b29-17+ |
| InChIKey | FAFRKXYSIQWLCL-STBIYBPSSA-N |
| XLogP | 5.36 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|