C27H29N3O6 — CID 126273066
N-[(E)-[4-(2-amino-2-oxoethoxy)-3-ethoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide (PubChem CID 126273066) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is N-[(E)-[4-(2-amino-2-oxoethoxy)-3-ethoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-ethoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126273066 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-ethoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(OCc3ccccc3)c(OCC)c2)ccc1OCC(N)=O |
| InChI | InChI=1S/C27H29N3O6/c1-3-33-24-14-20(10-12-22(24)36-18-26(28)31)16-29-30-27(32)21-11-13-23(25(15-21)34-4-2)35-17-19-8-6-5-7-9-19/h5-16H,3-4,17-18H2,1-2H3,(H2,28,31)(H,30,32)/b29-16+ |
| InChIKey | YYMOSACOLAZDCD-MUFRIFMGSA-N |
| XLogP | 3.69 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|