C22H21N3O3 — CID 7332800
N-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]pyridine-4-carboxamide (PubChem CID 7332800) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 7332800 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]pyridine-4-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccncc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H21N3O3/c1-2-27-21-14-18(15-24-25-22(26)19-10-12-23-13-11-19)8-9-20(21)28-16-17-6-4-3-5-7-17/h3-15H,2,16H2,1H3,(H,25,26)/b24-15- |
| InChIKey | OCAIWJLYRXXTDL-IWIPYMOSSA-N |
| XLogP | 3.82 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|