C28H25ClN2O4 — CID 3279486
N-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-3-methoxynaphthalene-2-carboxamide (PubChem CID 3279486) has the molecular formula C28H25ClN2O4 and a molecular weight of 488.97 g/mol. Its IUPAC name is N-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3279486 |
| Molecular Formula | C28H25ClN2O4 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | N-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-3-methoxynaphthalene-2-carboxamide |
| SMILES | CCOc1cc(C=NNC(=O)c2cc3ccccc3cc2OC)cc(Cl)c1OCc1ccccc1 |
| InChI | InChI=1S/C28H25ClN2O4/c1-3-34-26-14-20(13-24(29)27(26)35-18-19-9-5-4-6-10-19)17-30-31-28(32)23-15-21-11-7-8-12-22(21)16-25(23)33-2/h4-17H,3,18H2,1-2H3,(H,31,32) |
| InChIKey | ZTIQFEJTUARVOC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|