C28H23ClN2O6 — CID 5243084
4-[[2-chloro-6-ethoxy-4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 5243084) has the molecular formula C28H23ClN2O6 and a molecular weight of 518.95 g/mol. Its IUPAC name is 4-[[2-chloro-6-ethoxy-4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-chloro-6-ethoxy-4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 5243084 |
| Molecular Formula | C28H23ClN2O6 |
| Molecular Weight | 518.95 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 4-[[2-chloro-6-ethoxy-4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(C=NNC(=O)c2cc3ccccc3cc2O)cc(Cl)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H23ClN2O6/c1-2-36-25-12-18(11-23(29)26(25)37-16-17-7-9-19(10-8-17)28(34)35)15-30-31-27(33)22-13-20-5-3-4-6-21(20)14-24(22)32/h3-15,32H,2,16H2,1H3,(H,31,33)(H,34,35) |
| InChIKey | XIXQCNHXMQZICY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.95 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|