C23H19BrClFN2O3 — CID 17245484
2-bromo-N-[(E)-[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 17245484) has the molecular formula C23H19BrClFN2O3 and a molecular weight of 505.77 g/mol. Its IUPAC name is 2-bromo-N-[(E)-[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(E)-[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 17245484 |
| Molecular Formula | C23H19BrClFN2O3 |
| Molecular Weight | 505.77 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | 2-bromo-N-[(E)-[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccccc2Br)cc(Cl)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H19BrClFN2O3/c1-2-30-21-12-16(13-27-28-23(29)18-5-3-4-6-19(18)24)11-20(25)22(21)31-14-15-7-9-17(26)10-8-15/h3-13H,2,14H2,1H3,(H,28,29)/b27-13+ |
| InChIKey | VOGDHNITAPIVLG-UVHMKAGCSA-N |
| XLogP | 5.98 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.77 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|