C26H26BrClN2O5 — CID 126328953
N-[(E)-[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide (PubChem CID 126328953) has the molecular formula C26H26BrClN2O5 and a molecular weight of 561.86 g/mol. Its IUPAC name is N-[(E)-[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide.
| Compound Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 126328953 |
| Molecular Formula | C26H26BrClN2O5 |
| Molecular Weight | 561.86 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(OCc3ccc(Br)cc3)c(OCC)c2)cc1OC |
| InChI | InChI=1S/C26H26BrClN2O5/c1-4-33-22-11-8-19(14-23(22)32-3)26(31)30-29-15-18-12-21(28)25(24(13-18)34-5-2)35-16-17-6-9-20(27)10-7-17/h6-15H,4-5,16H2,1-3H3,(H,30,31)/b29-15+ |
| InChIKey | XYOWDWITPFNHKW-WKULSOCRSA-N |
| XLogP | 6.25 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.86 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|