C26H26ClN3O7 — CID 126330929
N-[(E)-[3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide (PubChem CID 126330929) has the molecular formula C26H26ClN3O7 and a molecular weight of 527.96 g/mol. Its IUPAC name is N-[(E)-[3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 126330929 |
| Molecular Formula | C26H26ClN3O7 |
| Molecular Weight | 527.96 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | N-[(E)-[3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(OCc3ccc([N+](=O)[O-])cc3)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C26H26ClN3O7/c1-4-35-22-11-8-19(14-23(22)36-5-2)26(31)29-28-15-18-12-21(27)25(24(13-18)34-3)37-16-17-6-9-20(10-7-17)30(32)33/h6-15H,4-5,16H2,1-3H3,(H,29,31)/b28-15+ |
| InChIKey | VLGIYNSUZUNUCW-RWPZCVJISA-N |
| XLogP | 5.40 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.96 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|