C21H17ClN4O5 — CID 56727043
N-[(E)-[3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 56727043) has the molecular formula C21H17ClN4O5 and a molecular weight of 440.84 g/mol. Its IUPAC name is N-[(E)-[3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 56727043 |
| Molecular Formula | C21H17ClN4O5 |
| Molecular Weight | 440.84 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | N-[(E)-[3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccncc2)cc(Cl)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H17ClN4O5/c1-30-19-11-15(12-24-25-21(27)16-6-8-23-9-7-16)10-18(22)20(19)31-13-14-2-4-17(5-3-14)26(28)29/h2-12H,13H2,1H3,(H,25,27)/b24-12+ |
| InChIKey | CVXRDUICIYVFFL-WYMPLXKRSA-N |
| XLogP | 3.99 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.84 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|