C24H21ClN4O7 — CID 126382340
N-[(E)-[3-chloro-5-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-nitrobenzamide (PubChem CID 126382340) has the molecular formula C24H21ClN4O7 and a molecular weight of 512.91 g/mol. Its IUPAC name is N-[(E)-[3-chloro-5-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(E)-[3-chloro-5-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 126382340 |
| Molecular Formula | C24H21ClN4O7 |
| Molecular Weight | 512.91 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | N-[(E)-[3-chloro-5-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-nitrobenzamide |
| SMILES | COc1ccccc1NC(=O)COc1c(Cl)cc(/C=N/NC(=O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C24H21ClN4O7/c1-34-20-6-4-3-5-19(20)27-22(30)14-36-23-18(25)11-15(12-21(23)35-2)13-26-28-24(31)16-7-9-17(10-8-16)29(32)33/h3-13H,14H2,1-2H3,(H,27,30)(H,28,31)/b26-13+ |
| InChIKey | JRFURVSLYMFOSA-LGJNPRDNSA-N |
| XLogP | 4.05 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|