C23H18Cl2N4O6 — CID 126255697
N-[(E)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-4-nitrobenzamide (PubChem CID 126255697) has the molecular formula C23H18Cl2N4O6 and a molecular weight of 517.33 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(E)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 126255697 |
| Molecular Formula | C23H18Cl2N4O6 |
| Molecular Weight | 517.33 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | N-[(E)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-4-nitrobenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc([N+](=O)[O-])cc2)cc(Cl)c1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C23H18Cl2N4O6/c1-34-20-11-14(12-26-28-23(31)15-6-8-16(9-7-15)29(32)33)10-18(25)22(20)35-13-21(30)27-19-5-3-2-4-17(19)24/h2-12H,13H2,1H3,(H,27,30)(H,28,31)/b26-12+ |
| InChIKey | IVIJOTIXHQCWEW-RPPGKUMJSA-N |
| XLogP | 4.69 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|