C24H20ClFN4O6 — CID 126366921
N-[(E)-[3-chloro-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-nitrobenzamide (PubChem CID 126366921) has the molecular formula C24H20ClFN4O6 and a molecular weight of 514.90 g/mol. Its IUPAC name is N-[(E)-[3-chloro-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(E)-[3-chloro-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 126366921 |
| Molecular Formula | C24H20ClFN4O6 |
| Molecular Weight | 514.90 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | N-[(E)-[3-chloro-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-nitrobenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc([N+](=O)[O-])cc2)cc(Cl)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H20ClFN4O6/c1-2-35-21-12-15(13-27-29-24(32)16-3-9-19(10-4-16)30(33)34)11-20(25)23(21)36-14-22(31)28-18-7-5-17(26)6-8-18/h3-13H,2,14H2,1H3,(H,28,31)(H,29,32)/b27-13+ |
| InChIKey | FEGYGPVIYLIQDN-UVHMKAGCSA-N |
| XLogP | 4.57 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.90 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|