C24H20Cl3N3O4 — CID 126272755
4-chloro-N-[(E)-[3-chloro-4-[2-(4-chloroanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide (PubChem CID 126272755) has the molecular formula C24H20Cl3N3O4 and a molecular weight of 520.80 g/mol. Its IUPAC name is 4-chloro-N-[(E)-[3-chloro-4-[2-(4-chloroanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(E)-[3-chloro-4-[2-(4-chloroanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126272755 |
| Molecular Formula | C24H20Cl3N3O4 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | 4-chloro-N-[(E)-[3-chloro-4-[2-(4-chloroanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(Cl)cc2)cc(Cl)c1OCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20Cl3N3O4/c1-2-33-21-12-15(13-28-30-24(32)16-3-5-17(25)6-4-16)11-20(27)23(21)34-14-22(31)29-19-9-7-18(26)8-10-19/h3-13H,2,14H2,1H3,(H,29,31)(H,30,32)/b28-13+ |
| InChIKey | QBRXXMYBVREYOG-XODNFHPESA-N |
| XLogP | 5.83 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|