C25H23BrClN3O4 — CID 126260622
4-bromo-N-[(E)-[3-chloro-5-ethoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126260622) has the molecular formula C25H23BrClN3O4 and a molecular weight of 544.83 g/mol. Its IUPAC name is 4-bromo-N-[(E)-[3-chloro-5-ethoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-bromo-N-[(E)-[3-chloro-5-ethoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126260622 |
| Molecular Formula | C25H23BrClN3O4 |
| Molecular Weight | 544.83 g/mol |
| Exact Mass | 543.06 |
| IUPAC Name | 4-bromo-N-[(E)-[3-chloro-5-ethoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(Br)cc2)cc(Cl)c1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C25H23BrClN3O4/c1-3-33-22-13-17(14-28-30-25(32)18-7-9-19(26)10-8-18)12-21(27)24(22)34-15-23(31)29-20-6-4-5-16(2)11-20/h4-14H,3,15H2,1-2H3,(H,29,31)(H,30,32)/b28-14+ |
| InChIKey | XKGFRYLXDKQULU-CCVNUDIWSA-N |
| XLogP | 5.59 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.83 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|