C24H21Cl2N3O4 — CID 126274135
N-[(E)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide (PubChem CID 126274135) has the molecular formula C24H21Cl2N3O4 and a molecular weight of 486.36 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide.
| Compound Name | N-[(E)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126274135 |
| Molecular Formula | C24H21Cl2N3O4 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | N-[(E)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccccc2)cc(Cl)c1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C24H21Cl2N3O4/c1-2-32-21-13-16(14-27-29-24(31)17-8-4-3-5-9-17)12-19(26)23(21)33-15-22(30)28-20-11-7-6-10-18(20)25/h3-14H,2,15H2,1H3,(H,28,30)(H,29,31)/b27-14+ |
| InChIKey | XIKQORHXEPEOHH-MZJWZYIUSA-N |
| XLogP | 5.17 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|