C24H20BrClN4O6 — CID 126257388
N-[(E)-[3-bromo-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-3-nitrobenzamide (PubChem CID 126257388) has the molecular formula C24H20BrClN4O6 and a molecular weight of 575.80 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(E)-[3-bromo-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126257388 |
| Molecular Formula | C24H20BrClN4O6 |
| Molecular Weight | 575.80 g/mol |
| Exact Mass | 574.03 |
| IUPAC Name | N-[(E)-[3-bromo-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-3-nitrobenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2cccc([N+](=O)[O-])c2)cc(Br)c1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C24H20BrClN4O6/c1-2-35-21-11-15(13-27-29-24(32)16-6-5-7-17(12-16)30(33)34)10-18(25)23(21)36-14-22(31)28-20-9-4-3-8-19(20)26/h3-13H,2,14H2,1H3,(H,28,31)(H,29,32)/b27-13+ |
| InChIKey | OWIJZWPGXSPEDF-UVHMKAGCSA-N |
| XLogP | 5.19 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.80 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|