C25H23BrN4O6 — CID 126262860
N-[(E)-[3-bromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-3-nitrobenzamide (PubChem CID 126262860) has the molecular formula C25H23BrN4O6 and a molecular weight of 555.39 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(E)-[3-bromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126262860 |
| Molecular Formula | C25H23BrN4O6 |
| Molecular Weight | 555.39 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | N-[(E)-[3-bromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-3-nitrobenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cccc([N+](=O)[O-])c2)cc(Br)c1OCC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C25H23BrN4O6/c1-15-7-8-19(9-16(15)2)28-23(31)14-36-24-21(26)10-17(11-22(24)35-3)13-27-29-25(32)18-5-4-6-20(12-18)30(33)34/h4-13H,14H2,1-3H3,(H,28,31)(H,29,32)/b27-13+ |
| InChIKey | OQYKPPLOPRKWFV-UVHMKAGCSA-N |
| XLogP | 4.76 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|