C24H21BrN4O5 — CID 126259090
N-[(E)-[3-bromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide (PubChem CID 126259090) has the molecular formula C24H21BrN4O5 and a molecular weight of 525.36 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(E)-[3-bromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126259090 |
| Molecular Formula | C24H21BrN4O5 |
| Molecular Weight | 525.36 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | N-[(E)-[3-bromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(/C=N/NC(=O)c3cccc([N+](=O)[O-])c3)cc2Br)cc1C |
| InChI | InChI=1S/C24H21BrN4O5/c1-15-6-8-19(10-16(15)2)27-23(30)14-34-22-9-7-17(11-21(22)25)13-26-28-24(31)18-4-3-5-20(12-18)29(32)33/h3-13H,14H2,1-2H3,(H,27,30)(H,28,31)/b26-13+ |
| InChIKey | FKYQUSUNIGIQDR-LGJNPRDNSA-N |
| XLogP | 4.76 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|