C25H24N4O7 — CID 4265248
N-[[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide (PubChem CID 4265248) has the molecular formula C25H24N4O7 and a molecular weight of 492.49 g/mol. Its IUPAC name is N-[[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4265248 |
| Molecular Formula | C25H24N4O7 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | N-[[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-nitrobenzamide |
| SMILES | CCOc1cc(C=NNC(=O)c2cccc([N+](=O)[O-])c2)ccc1OCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H24N4O7/c1-3-35-23-13-17(15-26-28-25(31)18-5-4-6-20(14-18)29(32)33)7-12-22(23)36-16-24(30)27-19-8-10-21(34-2)11-9-19/h4-15H,3,16H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | IQIYIQPRSZBBNJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|