C17H16N4O6 — CID 96884567
N-[(E)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-3-nitrobenzamide (PubChem CID 96884567) has the molecular formula C17H16N4O6 and a molecular weight of 372.34 g/mol. Its IUPAC name is N-[(E)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 96884567 |
| Molecular Formula | C17H16N4O6 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-3-nitrobenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cccc([N+](=O)[O-])c2)ccc1OCC(N)=O |
| InChI | InChI=1S/C17H16N4O6/c1-26-15-7-11(5-6-14(15)27-10-16(18)22)9-19-20-17(23)12-3-2-4-13(8-12)21(24)25/h2-9H,10H2,1H3,(H2,18,22)(H,20,23)/b19-9+ |
| InChIKey | WUQSFZFIQUAPSE-DJKKODMXSA-N |
| XLogP | 1.23 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|