C26H25N3O7 — CID 3667452
[2-methoxy-4-[[(3-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 4-butoxybenzoate (PubChem CID 3667452) has the molecular formula C26H25N3O7 and a molecular weight of 491.50 g/mol. Its IUPAC name is [2-methoxy-4-[[(3-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 4-butoxybenzoate.
| Compound Name | [2-methoxy-4-[[(3-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 3667452 |
| Molecular Formula | C26H25N3O7 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | [2-methoxy-4-[[(3-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(C=NNC(=O)c3cccc([N+](=O)[O-])c3)cc2OC)cc1 |
| InChI | InChI=1S/C26H25N3O7/c1-3-4-14-35-22-11-9-19(10-12-22)26(31)36-23-13-8-18(15-24(23)34-2)17-27-28-25(30)20-6-5-7-21(16-20)29(32)33/h5-13,15-17H,3-4,14H2,1-2H3,(H,28,30) |
| InChIKey | JHRTZYDXUWFJIQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|