C28H28ClN3O6 — CID 6109830
[4-[(Z)-[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-butoxybenzoate (PubChem CID 6109830) has the molecular formula C28H28ClN3O6 and a molecular weight of 538.00 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-butoxybenzoate.
| Compound Name | [4-[(Z)-[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 6109830 |
| Molecular Formula | C28H28ClN3O6 |
| Molecular Weight | 538.00 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | [4-[(Z)-[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(/C=N\NC(=O)CNC(=O)c3cccc(Cl)c3)cc2OC)cc1 |
| InChI | InChI=1S/C28H28ClN3O6/c1-3-4-14-37-23-11-9-20(10-12-23)28(35)38-24-13-8-19(15-25(24)36-2)17-31-32-26(33)18-30-27(34)21-6-5-7-22(29)16-21/h5-13,15-17H,3-4,14,18H2,1-2H3,(H,30,34)(H,32,33)/b31-17- |
| InChIKey | PVISKBDPHRWEOG-LJUMEUDFSA-N |
| XLogP | 4.63 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.00 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|