C25H22ClN3O5 — CID 3860866
[4-[[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate (PubChem CID 3860866) has the molecular formula C25H22ClN3O5 and a molecular weight of 479.92 g/mol. Its IUPAC name is [4-[[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate.
| Compound Name | [4-[[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 3860866 |
| Molecular Formula | C25H22ClN3O5 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [4-[[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C=NNC(=O)CNC(=O)c3cccc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C25H22ClN3O5/c1-2-33-21-12-8-18(9-13-21)25(32)34-22-10-6-17(7-11-22)15-28-29-23(30)16-27-24(31)19-4-3-5-20(26)14-19/h3-15H,2,16H2,1H3,(H,27,31)(H,29,30) |
| InChIKey | ZQDZLUWBPSCRNY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|