C23H17BrClN3O4 — CID 6117349
[4-[(Z)-[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 6117349) has the molecular formula C23H17BrClN3O4 and a molecular weight of 514.76 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[(Z)-[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 6117349 |
| Molecular Formula | C23H17BrClN3O4 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 513.01 |
| IUPAC Name | [4-[(Z)-[[2-[(3-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | O=C(CNC(=O)c1cccc(Cl)c1)N/N=C\c1ccc(OC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H17BrClN3O4/c24-18-8-6-16(7-9-18)23(31)32-20-10-4-15(5-11-20)13-27-28-21(29)14-26-22(30)17-2-1-3-19(25)12-17/h1-13H,14H2,(H,26,30)(H,28,29)/b27-13- |
| InChIKey | LYGNUXZCDDQWBU-WKIKZPBSSA-N |
| XLogP | 4.20 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|