C24H20BrN3O4 — CID 6185832
[4-[(Z)-[[2-[(2-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 6185832) has the molecular formula C24H20BrN3O4 and a molecular weight of 494.35 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(2-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[(Z)-[[2-[(2-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 6185832 |
| Molecular Formula | C24H20BrN3O4 |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | [4-[(Z)-[[2-[(2-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | Cc1ccccc1C(=O)NCC(=O)N/N=C\c1ccc(OC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H20BrN3O4/c1-16-4-2-3-5-21(16)23(30)26-15-22(29)28-27-14-17-6-12-20(13-7-17)32-24(31)18-8-10-19(25)11-9-18/h2-14H,15H2,1H3,(H,26,30)(H,28,29)/b27-14- |
| InChIKey | KNNJACLGQMITDY-VYYCAZPPSA-N |
| XLogP | 3.86 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|