C26H32BrN3O4 — CID 6181750
[4-[(Z)-[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 6181750) has the molecular formula C26H32BrN3O4 and a molecular weight of 530.46 g/mol. Its IUPAC name is [4-[(Z)-[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[(Z)-[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 6181750 |
| Molecular Formula | C26H32BrN3O4 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | [4-[(Z)-[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | CCCCCCCCCC(=O)NCC(=O)N/N=C\c1ccc(OC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C26H32BrN3O4/c1-2-3-4-5-6-7-8-9-24(31)28-19-25(32)30-29-18-20-10-16-23(17-11-20)34-26(33)21-12-14-22(27)15-13-21/h10-18H,2-9,19H2,1H3,(H,28,31)(H,30,32)/b29-18- |
| InChIKey | HXUSIXSRFGLWON-MIXAMLLLSA-N |
| XLogP | 5.38 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|