C26H32ClN3O4 — CID 4056292
[4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 4056292) has the molecular formula C26H32ClN3O4 and a molecular weight of 486.01 g/mol. Its IUPAC name is [4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4056292 |
| Molecular Formula | C26H32ClN3O4 |
| Molecular Weight | 486.01 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | [4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | CCCCCCCCCC(=O)NCC(=O)NN=Cc1ccc(OC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H32ClN3O4/c1-2-3-4-5-6-7-8-9-24(31)28-19-25(32)30-29-18-20-10-16-23(17-11-20)34-26(33)21-12-14-22(27)15-13-21/h10-18H,2-9,19H2,1H3,(H,28,31)(H,30,32) |
| InChIKey | NCFGLPOJYJUBBQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.01 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|