C28H36ClN3O5 — CID 3859539
[4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate (PubChem CID 3859539) has the molecular formula C28H36ClN3O5 and a molecular weight of 530.07 g/mol. Its IUPAC name is [4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 3859539 |
| Molecular Formula | C28H36ClN3O5 |
| Molecular Weight | 530.07 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | [4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate |
| SMILES | CCCCCCCCCC(=O)NCC(=O)NN=Cc1ccc(OC(=O)c2ccc(Cl)cc2)c(OCC)c1 |
| InChI | InChI=1S/C28H36ClN3O5/c1-3-5-6-7-8-9-10-11-26(33)30-20-27(34)32-31-19-21-12-17-24(25(18-21)36-4-2)37-28(35)22-13-15-23(29)16-14-22/h12-19H,3-11,20H2,1-2H3,(H,30,33)(H,32,34) |
| InChIKey | GBEWKNSFCWUNOF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.07 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|