C29H39N3O6 — CID 6091927
[4-[(Z)-[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-ethoxybenzoate (PubChem CID 6091927) has the molecular formula C29H39N3O6 and a molecular weight of 525.65 g/mol. Its IUPAC name is [4-[(Z)-[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-ethoxybenzoate.
| Compound Name | [4-[(Z)-[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 6091927 |
| Molecular Formula | C29H39N3O6 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | [4-[(Z)-[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-ethoxybenzoate |
| SMILES | CCCCCCCCCC(=O)NCC(=O)N/N=C\c1ccc(OC(=O)c2ccc(OCC)cc2)c(OC)c1 |
| InChI | InChI=1S/C29H39N3O6/c1-4-6-7-8-9-10-11-12-27(33)30-21-28(34)32-31-20-22-13-18-25(26(19-22)36-3)38-29(35)23-14-16-24(17-15-23)37-5-2/h13-20H,4-12,21H2,1-3H3,(H,30,33)(H,32,34)/b31-20- |
| InChIKey | JSNQIMALWJOMFH-GTWSWNCMSA-N |
| XLogP | 5.02 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|