C28H38ClN3O4 — CID 3688107
N-[2-[2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]decanamide (PubChem CID 3688107) has the molecular formula C28H38ClN3O4 and a molecular weight of 516.08 g/mol. Its IUPAC name is N-[2-[2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]decanamide.
| Compound Name | N-[2-[2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]decanamide |
|---|---|
| PubChem CID | 3688107 |
| Molecular Formula | C28H38ClN3O4 |
| Molecular Weight | 516.08 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | N-[2-[2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCC(=O)NN=Cc1ccc(OCc2ccc(Cl)cc2)c(OCC)c1 |
| InChI | InChI=1S/C28H38ClN3O4/c1-3-5-6-7-8-9-10-11-27(33)30-20-28(34)32-31-19-23-14-17-25(26(18-23)35-4-2)36-21-22-12-15-24(29)16-13-22/h12-19H,3-11,20-21H2,1-2H3,(H,30,33)(H,32,34) |
| InChIKey | VVKQPDQGQZADOQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.08 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|