C27H36ClN3O4 — CID 5225840
N-[2-[2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]decanamide (PubChem CID 5225840) has the molecular formula C27H36ClN3O4 and a molecular weight of 502.06 g/mol. Its IUPAC name is N-[2-[2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]decanamide.
| Compound Name | N-[2-[2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]decanamide |
|---|---|
| PubChem CID | 5225840 |
| Molecular Formula | C27H36ClN3O4 |
| Molecular Weight | 502.06 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | N-[2-[2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCC(=O)NN=Cc1ccc(OCc2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H36ClN3O4/c1-3-4-5-6-7-8-9-10-26(32)29-19-27(33)31-30-18-22-13-16-24(25(17-22)34-2)35-20-21-11-14-23(28)15-12-21/h11-18H,3-10,19-20H2,1-2H3,(H,29,32)(H,31,33) |
| InChIKey | JIYNYDHVPCYQDC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.06 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|